Answer:
Mass = 25.08 g
Explanation:
Given data:
Volume of fluorine = 29.6 L
Temperature = standard = 273.15 K
Pressure = standard = 1 atm
Mass of fluorine = ?
Solution:
The given problem will be solve by using general gas equation,
PV = nRT
P= Pressure
V = volume
n = number of moles
R = general gas constant = 0.0821 atm.L/ mol.K
T = temperature in kelvin
n = PV/RT
n = 1 atm × 29.6 L / 0.0821 atm.L/ mol.K × 273.15 K
n = 1.32 mol
Mass of fluorine:
Mass = number of moles × molar mass
Mass = 1.32 mol ×19 g/mol
Mass = 25.08 g
Mercury bc it is melting and getting closer
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
The answer is argon. Pls mark as brainliest
<span>Answer: 8.15s
</span><span />
<span>Explanation:
</span><span />
<span>1) A first order reaction is that whose rate is proportional to the concenration of the reactant:
</span><span />
<span>r = k [N]
</span><span />
<span>r = - d[N]/dt =
</span><span />
<span>=> -d[N]/dt = k [N]
</span><span />
<span>2) When you integrate you get:
</span><span />
<span>N - No = - kt
</span>
<span></span><span /><span>
3) Half life => N = No / 2, t = t'
</span><span />
<span>=> No - No/ 2 = kt' => No /2 = kt' => t' = (No/2) / k
</span><span />
<span>3) Plug in the data given: No = 0.884M, and k = 5.42x10⁻²M/s
</span>
<span /><span /><span>
t' = (0.884M/2) / (5.42x10⁻²M/s) = 8.15s</span>
