A cold-blooded animal. Cold-blooded animals can't generate heat themselves so they have to use external sources to keep them warm.
Answer:
32.7 g of Zn
Explanation:
We'll begin by writing the balanced equation for the reaction. This is illustrated below:
Zn + 2HCl —> ZnCl₂ + H₂
From the balanced equation above,
1 mole of Zn reacted to produce 1 mole of H₂
Next, we shall determine the number of mole of Zn required to produce 0.5 mole of H₂. This can be obtained as follow:
From the balanced equation above,
1 mole of Zn reacted to produce 1 mole of H₂.
Therefore, 0.5 mole of Zn will also react to produce to 0.5 mole of H₂.
Thus, 0.5 mole of Zn is required.
Finally, we shall determine the mass of 0.5 mole of Zn. This can be obtained as follow:
Mole of Zn = 0.5 mole
Molar mass of Zn = 65.4 g/mol
Mass of Zn =?
Mass = mole × molar mass
Mass of Zn = 0.5 × 65.4
Mass of Zn = 32.7 g
Thus, 32.7 g of Zn is required to produce 0.5 mole of H₂.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer: At the point when space experts take a gander at an article's range, they can decide its arrangement dependent on these frequencies. The most well-known technique stargazers use to decide the sythesis of stars, planets, and different articles is spectroscopy. This spread-out light is known as a range.
Explanation:
Conductivity, malleability, and high melting points. Hope this helps :)
