Ask question

Ask question

All categories

3 years ago

12

chad has 22 coins in his pocket, all of which are dimes and quarters. if the total value of his change is 460 cents, how many di

mes and how many quarters does he have?

1 answer:

Alenkinab [10]3 years ago

6 0

Answer: delete this plz

Step-by-step explanation:

You might be interested in

Value of sin^6 + cos^6+3sin^2cos^2

Sav [38]

Step-by-step explanation:

If you put into a calculator "Sin(6)+Cos(6)+3Sin(2)Cos(2)", you get 1.20368506925. Hope that helps

4 0

3 years ago

Questions are in the picture

gtnhenbr [62]

The closest point is (3.5, 1.9) and the distance is 1.96 units

<h3>How to determine the point and the distance?</h3>

The coordinate is given as:

(4, 0)

The equation of the function is

y = √x

The distance between two points is calculated using

d = √(x2 - x1)^2 + (y2 - y1)^2

So, we have the following points

(x1, y1) = (4, 0) and (x2, y2) = (x, 0)

This gives

d = √(x - 4)^2 + (√x - 0)^2

Evaluate the difference

d = √(x - 4)^2 + (√x)^2

Evaluate the exponent

d = √x^2 - 8x + 16 + x

Evaluate the like terms

d = √x^2 - 7x + 16

Next, we differentiate using a graphing calculator

d' = (2x - 7)/[2√(x^2 - 7x + 16)]

Set to 0

(2x - 7)/[2√(x^2 - 7x + 16)] = 0

Cross multiply

2x - 7 = 0

Add 7 to both sides

2x = 7

Divide by 2

x = 3.5

So, we have:

Substitute x = 3.5 in y = √x

y = √3.5

Evaluate

y = 1.9

So, the point is (3.5, 1.9)

The distance is then calculated as:

d = √(x2 - x1)^2 + (y2 - y1)^2

This gives

d = √(3.5 - 4)^2 + (1.9 - 0)^2

Evaluate

d = 1.96

Hence, the closest point is (3.5, 1.9) and the distance is 1.96 units

Read more about distance at:

brainly.com/question/23848540

#SPJ1

3 0

1 year ago

Natalie has $5000 and decides to put her money in the bank in an account that has a 10% interest rate that is compounded continu

kakasveta [241]

Step-by-step explanation:

Natalie has $5000

She decides to put her money in the bank in an account that has a 10% interest rate that is compounded continuously.

Part a) What type of exponential model is Natalie’s situation?

Answer:

As Natalie's situation implies

continuous compounding. So, instead of computing interest on a finite number of time periods, for instance monthly or yearly, continuous compounding computes interest assuming constant compounding over an infinite number of periods.

So, it requires the more generalized version of the principal calculation formula such as:

$P\left(t\right)=P_0\times \left[1+\left(i\:/\:n\right)\right]^{\left(n\:\times \:\:t\right)}$

or

$P\left(t\right)=P_0\times \left[1+\left(\frac{i}{n}\:\right)\right]^{\left(n\:\times \:\:t\right)}$

Here,

$i$ = interest rate

= number of compounding periods

$t$ = time period in years

Part b) Write the model equation for Natalie’s situation?

For continuous compounding the number of compounding periods, $n$ , becomes infinitely large.

Therefore, the formula as we discussed above would become:

$P\left(t\right)=P_0\times e^{\left(i\:\times \:t\right)}$

Part c) How much money will Natalie have after 2 years?

Using the formula

$P\left(t\right)=P_0\times e^{\left(i\:\times \:t\right)}$

$₂ $=\:6107.02$ $

So, Natalie will have $\:6107.02$ $ after 2 years.

Part d) How much money will Natalie have after 2 years?

Using the formula

$P\left(t\right)=P_0\times e^{\left(i\:\times \:t\right)}$

$₁₀ $=13.597.50$ $

So, Natalie will have $13.597.50$ $ after 10 years.

Keywords: word problem, interest

Learn more about compound interest from brainly.com/question/6869962

#learnwithBrainly

5 0

3 years ago

What is the equivalent measure for 1 cup?

mash [69]

16 TBSP (tablespoon)

8 (fluid ounces)

6 0

2 years ago

Properties of parallelograms worksheet answers milliken publishing company mp3497 page 24

jasenka [17]

Answer:

what?

Step-by-step explanation:

6 0

3 years ago