There’s lots of measurements. (m, kg, s, mol, cm, in, mm) etc
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer: The temperature of 0.6 moles of fluorine that occupy 15 L at 2,300 mmHg is 920 K
Explanation:
According to ideal gas equation:

P = pressure of gas = 2300 mm Hg = 3.02 atm (760mmHg=1atm)
V = Volume of gas = 15 L
n = number of moles = 0.6
R = gas constant =
T =temperature = ?


Thus the temperature of 0.6 moles of fluorine that occupy 15 L at 2,300 mmHg is 920 K
The number of molecules : 4.967 x 10²⁴
<h3>Further explanation
</h3>
A mole is a number of particles(atoms, molecules, ions) in a substance
This refers to the atomic total of the 12 gr C-12 which is equal to 6.02.10²³, so 1 mole = 6.02.10²³ particles
Can be formulated :
N = n x No
N = number of particles
n = mol
No = 6.02.10²³ = Avogadro's number
8.25 moles of C₈H₁₈
The number of molecules :
