Answer:
Explanation:
We can use the specific heat formula, which is:
Where <em>q</em> is the energy, <em>m</em> is the mass, <em>c</em> is the specific heat capacity, and ΔT is the change in temperature.
We know the mass is 250 grams. The specific heat capacity of water is 4.18 joules per gram degree Celsius. Let's find the change in temperature.
- ΔT = final temperature - initial temperature
Now we know all the values:
Substitute the known values into the formula.
Multiply the first 2 numbers together. The grams will cancel out.
Multiply again. This time the degrees Celsius will cancel out.
The energy needed is <u>80, 465 Joules.</u>
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
Explanation:
The breakdown reaction of ozone is as follows
It can be seen that 2 moles of ozone is required in the complete cycle
So for 10 cycles, 20 moles of ozone is required
m = Mass of = 15.5 g
M = Molar mass of = 104.46 g/mol
P = Pressure = 24.5 mmHg
T = Temperature = 232 K
R = Gas constant =
Number of moles is given by
From ideal gas law we have
For 20 cycles of the reaction the volume of the ozone is .
When AMP receives a phosphate molecule ADP is formed. When ADP receives a phosphate molecule ATP is formed.
Hope this is what you are looking for.
Answer:
e. the strong base reacts with HA to give A, which is a weak base
Explanation:
Let's consider a buffer made up of a weak acid, HA, and the sodium salt of its conjugate base, NaA. The function is a buffer system is to muffle the change in the pH when an acid or a base is added.
Let's suppose a strong base is added. Then, OH⁻ would be more available. OH⁻ ions react with the acid component of the buffer and its effect is reduced. The corresponding reaction is:
OH⁻ + HA ⇄ A⁻ + H₂O
As we can see, the strong base reacts with HA to give A, which is a weak base.