Compound. An element is just composed of itself. A carbohydrate is a complex compound made with carbpn and lots of other elements
That number has five significant figures
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
<span>According to its definition, the answer is: The characteristics that best describe the tail of a phospholipid molecule are </span><span>a. neutral charge, nonpolar, and hydrophobic</span>
Propes I think
Sorry if it’s wrong
