A substance can dissolve in another when they have thee same type of intermolecular interaction.
<h3>What is solubility?</h3>
The term solubility of a solute refers to the extent to which a solute dissolve in a solvent. We must know that a substance can dissolve in another when they have thee same type of intermolecular interaction.
Thus;
a) Octane (C8H18) mixes well with CCl4 because they are both non polar substances.
b) Methanol (CH3OH) is mixed with water in all ratios because the both are polar substances.
c) NaBr dissolves very poorly in acetone (CH3 ― CO ― CH3) because acetone is only slightly polar.
Learn more about solubility:brainly.com/question/8591226
#SPJ1
Answer: In order to increase the rate of reaction between hydrochloric acid and sugar increase the concentration of hydrochloric acid to 2 M because greater concentration results in more collision between the reactants.
Explanation:
More is the concentration of reactant molecules more will be the number of collisions between their molecules. As a result, more readily the products will be formed.
Hence, for the given reaction when concentration of HCl is increased then there will be increase in the number of collisions between reactants.
Thus, we can conclude that in order to increase the rate of reaction between hydrochloric acid and sugar increase the concentration of hydrochloric acid to 2 M because greater concentration results in more collision between the reactants.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
the energy gained by proteins and carbohydrates differs from the energy gained by fats.
proteins and carbohydrates both give 4 kcal per gram
fats give 9 kcal per gram
mass of proteins - 2 g
energy given by proteins - 2 g x 4 kcal/g = 8 cal
mass of carbohydrates - 20 g
energy given by carbohydrates - 20 g x 4 kcal/g = 80 cal
mass of fat - 1 g
energy given by fat - 1 g x 9 kcal/g = 9 cal
total energy = 8 + 80 + 9 = 97 kcal
energy = 97 kcal
