Answer:
It is a force acting on the object.
Explanation:
The answer option which is true about the weight of an object is: C. It is a force acting on the object.
Weight can be defined as the force acting on a physical body or an object as a result of gravity. Also, the weight of an object is measured in Newton.
Mathematically, the weight of an object is given by the formula;
Where;
m is the mass of the object.
g is the acceleration due to gravity.
In conclusion, the weight of an object is the force acting on an object due to gravity.
The compound that will have a sweet smell would be the one, whereby the molecular formula closely resembles that of an ether
R-O-R.
I believe the third one
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer: The coefficient is 3.645
The exponent is 1
There are 4 significant digits
The rightmost significant figure is 5
Explanation:
Scientific notation is defined as the representation of expressing the numbers that are too big or too small and are represented in the decimal form with one digit before the decimal point times 10 raise to the power.
For example : 5000 is written as 
According to avogadro's law, 1 mole of every gas contains avogadro's number 
of particles, occupy 22.4 L at STP and weighs equal to its molecular mass.
131.29 g of Xe occupy = 22.4 L at STP.
Thus 213.62 g of 
occupy = 
at STP.
Scientific notation = 
The coefficient is 3.645
The exponent is 1
There are 4 significant digits
The rightmost significant figure is 5
Answer:
The rate of leakage will be higher for helium; its molecules move about 3 times faster than oxygen’s
Explanation:
Step 1: Data given
Molar mass helium = 4.0 g/mol
Molar mass O2 = 32 g/mol
Step 2: Graham's law
Graham's Law of Effusion states that the rate of effusion of a gas is inversely proportional to the square root of the molecular mass : 1/(Mr)^0.5
Rate of escape for He = 1/(4.0)^0.5 = 0.5
Rate of escape for O2 = 1/(32)^0.5 = 0.177
The rate of leakage will be higher for helium; its molecules move about 3 times faster than oxygen’s
