Answer:
psychical change
Explanation:
chemical change is when substances combine and that’s not what’s happening
<h3><u>Answer;</u></h3>
C. increasing the surface area of Fe2O3
<h3><u>Explanation;</u></h3>
- The rate of reaction refers to the speed at which products are formed from reactants.
- The rate of any chemical reaction depends on a number of factors which include, surface area, temperature, concentration of reactants among others.
- <em><u>When solids and liquids react, increasing the surface area of the solid will increase the rate of reaction. Thus, decrease in the size of particles causes an increase in the total surface area of the solid and therefore increasing the rate of reaction.</u></em>
By increasing atomic number
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH