The molecules of a liquid substance are closely packed together to each other. So as a result, liquids are denser than gases.
<h3>
What is the difference between the density of liquid and gas?</h3>
A mass of gas will have a much larger volume compared to the same mass of liquid. This is because it has a much lower density. The density of gaseous oxygen is 0.0014 g/cm3. Density is ρ=Mass Volume. We know that gas will uniformly occupy more space than liquid whatever volume is available to it. On the other hand, solids and liquids, are closely packed as compared to gas and are high-density materials where ρ is relatively constant.
So we can conclude that the molecules of a liquid substance are closely packed together with each other. So as a result, liquids are denser than gases.
Learn more about Density: brainly.com/question/1354972
#SPJ1
They move because of convection currents in the mantle
Answer: The final volume of this solution is 0.204 L.
Explanation:
Given: Molarity of solution = 2.2 M
Moles of solute = 0.45 mol
Molarity is the number of moles of solute present divided by volume in liters.
Substitute the values into above formula as follows.
Thus, we can conclude that the final volume of this solution is 0.204 L.
Answer:
Total pressure increased
Explanation:
When gas C is added in the vessel then number of mole increases and number of collision depends on the number of molecules present in the vessel and on adding gas C ,mole also increases hence number of collision increases therefore pressure also increases because number of collision increases.
Total pressure increases.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
