The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer: Atomic Nucleus!
Explanation: All atoms have a dense central core called the atomic nucleus. Forming the nucleus are two kinds of particles: protons, which have a positive electrical charge, and neutrons, which have no charge.
(Yes, it was from google.)
Answer:
C
Explanation:
As the temperature increases, the kinetic energy of the molecules increases.
A nuclear reaction in which a heavy nuclear splits spontaneously or on impact with another particle with the release of energy- fission
A nuclear reaction in which atomic nucleus with the release of energy-fusion
The energy harnessed in nuclei is released in nuclear reaction. Fission is the splitting of a heavy nucleus into lighter nuclei and fusion is the combining of nuclei to form a bigger and heavier nucleus
1. Density=mass/volume=2kg/6m=0.33kg/m (convert to proper units)
2. Density=mass/volume=0.6kg/3L=0.2kg/L (convert to proper units)
3. Density=mass/volume= 129g / 30 cm (convert to proper units)
V=length*width*height=2*3*5 = 30
4. Volume (units) = cm^3 because, like in problem 3, Volume=width(cm)*length(cm)*height(cm)
However, when you pour liquid into a cylinder (so the volume would be the liquid), you measure it in mL.
5. Volume with rock - initial volume (without the rock) = Volume of rock
18.2-12.7= 5.5
