Answer:
The wavelength for the transition from n = 4 to n = 2 is<u> 486nm</u> and the name name given to the spectroscopic series belongs to <u>The Balmer series.</u>
Explanation
lets calculate -
Rydberg equation- 
where ,
is wavelength , R is Rydberg constant ( 
), 
and 
are the quantum numbers of the energy levels. (where 
)
Now putting the given values in the equation,
Wavelength 
=
= 486nm
<u> Therefore , the wavelength is 486nm and it belongs to The Balmer series.</u>
Answer:
Yes, this is true. The reason is that the flower transpires and sucks the water in and distributes it as much as it can. You can also flip it upside down and hang it with petals down , allowing the liquid to enter the flower and then retaining color for longer periods of time and having more color.
Explanation:
Answer:
The atmosphere traps heat energy from the Sun and energy radiated from Earth's surface helping to maintain Earth's climate
Explanation:
Earth's atmosphere keeps much of the Sun's energy from escaping into space. This process, called the greenhouse effect, keeps the planet warm enough for life to exist. The atmosphere allows about half of the Sun's heat energy (50%) to reach Earth's surface.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
There are six electrons in the covalent bonds.
Two N atoms would be :N:· + ·:N:
An N₂ molecule would be :N:::N: or :N≡N:
This gives each N atom an octet of eight electrons in its valence shell.
