The part of the atom that is involved in chemical changes is A. electron. The electrons that are in the most outer shells are called valence electrons which are easily removed or shared to form bonds. Valence electrons are related to the number of valence electrons
Ionic bonding is the complete transfer of valence electron(s) between atoms. It is a type of chemical bond that generates two oppositely charged ions. In ionic bonds, the metal loses electrons to become a positively charged cation, whereas the nonmetal accepts those electrons to become a negatively charged anion.
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
Answer:
Well they didn't transfer any energy when they weren’t touching and it did t produce any energy if it didn’t move. Since they are on top of each other they are causing momentum on each other creating kinetic energy
Explanation:
7 becuse it splits in half
