Answer:
1.1 percent
Explanation:
C6H5COOH⇌C6H5COO+H
Ka = [C6H5COO-][H+]/[C6H5COOH]
From pKa of 4.2, Ka = 6.3x10^-5
6.3x10^-5 = (x)(x)/0.51-x and assuming x is small...
6.3x10^-5 = x^2/0.51
x^2 = 3.213x10^-5
x =5.67 x10^-3
(5.67x10^-3/0.51)x 100 =1.1 percent
Answer:
Over the last century the burning of fossil fuels like coal and oil has increased the concentration of atmospheric carbon dioxide (CO2). This happens because the coal or oil burning process combines carbon with oxygen in the air to make CO2. as u know decreasing means going down and increasing means going up. the reason why things decrease means something went wrong or something to happen to make it go down we all try to make things increase which means we try to make things go up instead of down. a lot of reasons is y things decrease is bc during the period of time something might go wrong or happen in a bad way that makes a lot of things decrease. for example like temperature when the temperature decreases it means it goes down and it might get cold but if the temperature increases it goes up so it might be ht or warm or maybe even cool. if something ever decreases it means during the period of time something bad happened and made it go down instead of up if something ever goes wrong that means something decreased. sometimes decreasing could be a good thing but most of the time it it bad but there are sometimes when decreasing is good but not all the time.
Answer:
2. Molten rock rises in Earth's mantle caused by (pressure)
Explanation:
i think i just had a similar question
B. Aquaculture means "cultivating small acreages of land."
Explanation:
Aquaculture is the growing of fishes, crustaceans, molluscs, oysters and other marine organisms like algae in a small acreage of farm. Normally, the carryign capacity per acreage would be lower in the natural habitat – like in the oceans- but this is raised substantially in aquaculture due to adopting certain farming techniques. An example is by cycling the wastewater from teh fish tanks to plants that take up the waste as nutrients and oxygenate the water, The water is then recycled back to the tanks as cleaner water reusable by the fishes and teh cycle continues. This cycle ensures the sustainability of the farm even with very little water compared to the natural environment.
<h3>
Answer: False</h3>
In solid form, ionic compounds do not conduct electricity. Ionic compounds will conduct electricity when melted to their liquid state. This is due to the electrons being locked in place when in solid form, but liquid form allows for the electrons to move freely.
