<span>Of the answers listed option B looks like the most complete. Ie "Check for the presence of alpha, beta, and gamma particles." the significant presence of these particles is a specific indicator of radioactive decay, i.e: unstable atoms spontaneously undergoing a nuclear reaction.</span>
Given:
Iron, 125 grams
T
1 = 23.5 degrees Celsius, T2 =
78 degrees Celsius.
Required:
Heat produced in kilojoules
Solution:
The molar mass of iron is 55.8
grams per mole. SO we need to change the given mass of iron into moles.
Number of moles of iron = 125 g/(55.8
g/mol) = 2.24 moles
<span>
Q (heat) = nRT = nR(T2 = T1)</span>
Q (heat) = 2.24 moles (8.314
Joules per mol degrees Celsius) (78.0 degrees Celsius – 23.5 degrees Celsius)
<u>Q (heat) = 1014.97 Joules or
1.015 kilojoules</u>
<span>This is the amount of heat
produced in warming 125 g f iron.</span>
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Elements are substances that are made up of the same atoms which are capable of taking part in a chemical reaction.
There are different types of elements which are represented by symbols gotten from the first letter or the first and any other letter in the name of the element.
Examples of elements include:
When two or more of these elements combine together through a chemical bond, it leads to the formation of compounds.
Example of a compound includes:
- NaCl: The element sodium combine, through electrochemical bonding, with another element chlorine to form the compound sodium chloride.
Learn more here:
brainly.com/question/17571315
Osmotic pressure is the pressure that would have to be applied to a pure solvent to prevent it from passing into a given solution by osmosis.
That can be mathematical computed from the expression:
Osmotic pressure=C×R×T
Where,
C= Concentration
R=Gas constant
T=Temperature
Concentration=Number of moles of solute/Volume(L)
=0.005*1000/100
=0.05
R= 0.08206 atm L/mol K
T=25+273
=298
Osmotic pressure= 0.05×0.08206×298
=1.2 atm
