Answer is: true.
Demand decreases and competition increases decrease the quantity supplied.
Quantity supplied is the quantity of a commodity that producers are willing to sell at a particular price at a particular point of time.
Quantity demanded is the quantity of a commodity that people are willing to buy at a particular price at a particular point of time.
Quantity demanded can change at the same price depending upon factors like recession, changes in the taste of the consumer.
Competition is rivalry between two or more economic groups.
Answer:
a) 210.3 g/mol
b) 210.2 g/mol
c) 384.5 g/mol
Explanation:
First step we will calculate the molar masses of ; carbon atom, hydrogen atom and oxygen atom in each .
<u> Molar mass of dibenzyl ketone</u>
Molar mass of dibenzyl ketone = ∑ molar masses of atoms in dibenzyl ketone
= carbon( 15 ) = 15 ( 12.0107 ) + oxygen ( 14 ) = 1 ( 15.999 ) + hydrogen(14) =14(1.00784)
= 210.26926 ≈ 210.3 g/mol
<u> Molar mass of benzil</u>
Molar mass of Benzil = ∑ molar masses of atoms in Benzil
= carbon( 14) = 14(12.0107) + oxygen(2) = 2 ( 15.999) + hydrogen(10) =10(1.00784)
= 210.2262 ≈ 210.2 g/mol
<u>Molar mass of 2,3,4,5-tetraphenylcyclopentadienone</u>
Molar mass = ∑ molar masses of atoms
= carbon ( 29) = 29(12.0107) + oxygen (1) = 1( 15.999 ) + hydrogen(20) = 20(1.00784 )
≈ 384.5 g/mol
Answer:
6 moles of oxygen
Explanation:We can find from the chemistry equation
C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)
6 moles O2 ~4 moles H2O
The high surface tension of water pulls the concavity outwards, generating enough force to lift water from the roots to the leaves of plants. Thus, Cohesion, along with adhesion and surface tension creates a capillary action that keeps water molecules interacting and moving through the plants out to the leaf cells.
Answer:
A) The atoms of the reactants unbond, rearrange and then rebond to form the products
Explanation:
Using method of elimination:
A) The atoms of the reactants unbond, rearrange and then rebond to form the products
This is the correct option. Chemical reactions involves breaking and forming of new bonds.
B) Some atoms disappear while others multiply to form the products
This option is incorrect. Atoms do not disappear
C) The atoms of the reactants always stay together to form the products
This option is incorrect. The bonds between the atoms in the reactants must first be broken before products can be formed.
D) New atoms are formed which combine to make the products
This option is incorrect. Atoms do not just form out of nowhere.
