The correct answer to your question would be B) Loess, or <span>Aeolian deposits , reasoning to your question is because, loess is a german word but in english means loss or loose. So given that clay and small particles that are not combined together are loose particles. moves freely. Hope this helps you out.
</span>
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
The answer would be 16.04.
In the given case, the scientist should use a circle graph or pie chart.
One can dissect a circle into smaller segments, a component of the circle is known as an arc and an arc is named on the basis of its angle. A pie chart, or a circle graph, is used to visualize data and information.
A circle graph is generally used to demonstrate the outcomes of an examination in a proportional way. In a circle graph, the arcs are proportional to how many percents of the population gave a particular answer.
Arsenic, I believe. Metalloids fall in between metals and nonmetals (usually on the bold line separating the two on the periodic table). And since the metalloid in question has four electron shells and five valence electrons in the outermost shell, you can see that this element is arsenic