Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
Boron has 3 valence electrons
The experimental method for measuring the change in concentration with time for the given reaction is by measuring the amount of gas a reaction releases over time.
2NO(g) + Cl₂(g) → 2NOCl(g)
<h3>What is reaction rate?</h3>
- The reaction rate is the rate at which a chemical reaction proceeds.
- Which is proportional to both the increase in a product's concentration per unit time and the decrease in a reactant's concentration per unit time.
- There is a wide range in reaction times.
- The general definition is that the term "rate of a reaction" refers to the pace at which a reaction occurs.
- As an illustration, iron rusting has a low reaction rate since the process is slow but wood burning has a high reaction rate because the process is quick.
Learn more about reaction rate here:
brainly.com/question/13440548
#SPJ4
Answer:
Red phosphorous can vary in colour from orange to purple, due to slight variations in its chemical structure. The third form, black phosphorous, is made under high pressure, looks like graphite and, like graphite, has the ability to conduct electricity.
Explanation:
