PO4 anion has a 3- charge.A sodium cation , has a 1+ charge.Now , you have to think how many Na ions you need to fully neutralize the PO4 's 3- charge. Answer 3. That's because a molecule must have a neutral charge (a 0 charge). 3+(-3)=0.So , sodium phosphate has the formula Na3PO4.
The oxidation number of O is -2 and there's 4 of them so the total is -8. Since it's a molecule the sum of the oxidation numbers of the atoms must equal 0. If 4 oxygen atoms have an oxidation number of -8 then the two S atoms must is +8 to equal 0 so the oxidation number of the S is 8/2 = +4
Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
Answer:
46.3g H2O
Explanation:
start by balancing it: CaC2(s) + 2H2O(g) -> Ca(OH)2(s) + C2H2(g)
then use factor label method to solve
82.4g CaC2 x (1 mol CaC2/64.10g CaC2) x (2 mol H2O/1 mol CaC2) x (18.016g H2O/1 mol H20) = 46.3g H2O
Answer:
Here's your Answer
Explanation:
the mass spectrum is the graphical representation of the ion abundance versus the mass to charge of the ions separated in mass spectrometer
