It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
One way you can work out the rate of reaction is by the amount of product that is produced to time. This can also be done with heat and time.
Hope this helps! :)
Answer:
Alpha particle
Explanation:
The helium symbol is also used to represent he alpha particles.
For example:
The americium with atomic wight 224 undergo alpha decay and produce
₉₃Np²³⁷ . The alpha particle emitted is also called helium nuclei. During this decay some gamma radiations also produce as a byproduct.
₉₅Am²²⁴ → ₉₃Np²³⁷ + ₂He⁴
Properties of alpha radiation:
Alpha radiations are emitted as a result of radioactive decay. The atom emit the alpha particles consist of two proton and two neutrons. Which is also called helium nuclei. When atom undergoes the alpha emission the original atom convert into the atom having mass number 4 less than and atomic number 2 less than the starting atom.
Alpha radiations can travel in a short distance.
These radiations can not penetrate into the skin or clothes.
These radiations can be harmful for the human if these are inhaled.
These radiations can be stopped by a piece of paper.
Ham, bacon, sausages, salami, pastrami, hot dogs, and other processed meat that is cured, smoked, or salted. The nitrite is used to preserve them.
The blank is filled by Na₂SO₄, and the complete equation for the double displacement reaction is:
Na₂SO₄ + BaCl₂ = BaSO₄ + 2 NaCl
<h3>What is a double displacement reaction?</h3>
It is a reaction in which both reactants exchange anions and cations.
Let's consider the following incomplete double displacement reaction.
_____ + BaCl₂ = BaSO₄ + 2 NaCl
If we compare the left and right sides, we can see that the missing ions in the left side are Na⁺ and SO₄²⁻. Thus, the missing compound is Na₂SO₄. The complete equation is:
Na₂SO₄ + BaCl₂ = BaSO₄ + 2 NaCl
Learn more about double displacement here: brainly.com/question/23918356
#SPJ1
