1.Type of bonding in which electrons are completely transferred is called ionic bond.
2. Isotopes have same atomic number but different atomic mass number.
Atomic number = number of protons + number of neutrons
Therefore, A is correct.
3. Nucleus is composed of neutrons and protons.
4. Chemical reactions follows the law of conservation of mass. Therefore mass of reactant = mass of product = 4 grams.
5. Again, mass of table salt formed should be equal to mass of (Na+Cl₂) = 4 grams.
Everything requires energy to move. If the desk is moving, then it has energy.
Answer:
11 electrons
Explanation:
The atomic number of sodium is 11. This tells us that sodium has 11 protons and because it is neutral it has 11 electrons. The mass number of an element tells us the number of protons AND neutrons in an atom (the two particles that have a measurable mass).
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
