What does polar molecules mean? Is it charged molecules? Does non polar mean that it is not charged?

2 answers:

5 0

The arrangement or geometry of the atoms in some molecules is such that one end of the molecule has a positive electrical charge and the other side has a negative charge. If this is the case, the molecule is called a polar molecule, meaning that it has electrical poles. Otherwise, it is called a non-polar molecule.

DedPeter [7]3 years ago

3 0

Polarity is about PARTIAL charges. There is no real charge involved. For example water (H2O) is a polar molecule, because O has a stronger electronegativity than H (that means O attracts electrons stronger than H). Because of this attraction the electrons are often next to the O and so we can say that O has a negative partial charge and both H's has a positive partial charge.

Non polar means no partial charged.

I hope I could help a bit (and sorry for the bad english)

You might be interested in

PLZ HELP!!

densk [106]

Because the cell membrane (plasmamembrane) is a membrane. Very simply put, you can think of it like a piece of cloth. If you have a piece of cloth, water can move through the small holes, but something large, like e.g. a piece of cheese cannot.

Sana maka tulong

3 0

2 years ago

Read 2 more answers

What is more likely to happen if wetlands are drained?

Rudik [331]

Animals and Plants won't have a place to live, get food and resourses. Some organisms won't have anyshelter, because some live in the water.

8 0

4 years ago

I don’t wanna fail if you know the answer pls help me :(

stealth61 [152]

Answer:

liquid and gas........................

7 0

3 years ago

How do you convert ethane to ethanoic acid? Please provide your equation.

tigry1 [53]

ester of Ethanol and Ethanoic Acid is Ethyl Ethanoate. 

C2H5OH(l)+CH3COOH(l)conc.H2SO4/warm−−−−−−−−−−−→CH3COOCH2CH3(aq)+H2O(l)C2H5OH(l)+CH3COOH(l)→conc.H2SO4/warmCH3COOCH2CH3(aq)+H2O(l)
Condition: Warm con. reactants with conc.Condition: Warm con. reactants with conc.H2SO4H2SO4

7 0

3 years ago

Virtually no chemical reaction can occur in the body in the absence of enzymes. how might excessively high body temperature or a

olchik [2.2K]

1. The structural unit of nucleic acids are composed of repeating units of monomers called nucleotides. Nucelotides are composed of three functional groups: sugars which are specifically pentoses (5-Carbon sugars), phosphate group and nitrogenous base.

2. The two major classes of nucleic acids in the body are the DNA or deoxyribonucleic acids and RNA or ribonucleic acids.

3.
a. Based on the nitrogenous bases and sugar, the DNA has a deoxyribose as the sugar and its 4 bases are adenine, guanine, cytosine and thymine. For RNA, the sugar is ribose while its 4 bases are adenine, guanine, cytosine, and uracil

b. Based on the general three-dimensional structure, DNA is a double stranded β-helix with a long chain of nucleotides. RNA is composed of a shorter chain with a single strand α-helix structure.

c. Based on relative functions, the DNA is responsible for storing the genetic information while the RNA is responsible for transporting the genetic information to the ribosomes which synthesize proteins.

8 0

3 years ago