All categories

2 years ago

Select the correct answer.

Chemistry

1 answer:

Scilla [17]2 years ago

5 0

Answer:

I think it Might Be C

Explanation:

I'm Not sure

You might be interested in

Why do nuclear reactions take place

jolli1 [7]

Answer:

Nuclear reaction occurs when an elementary particle or another nucleus has enough energy to disturb internal structure of a bombarded nucleus to such a level that it undergoes a transition to a different state.

5 0

3 years ago

On the addition of HI

victus00 [196]

Answer:

$CH_3-CH(I)-CH(CH_3)-CH_3$

$I-CH_2-CH_2-CH(CH_3)-CH_3$

Explanation:

Given the compound $CH_2=CH-CH(CH_3)-CH_3$

The steps of reaction:

$HI \longrightarrow H^+ + I^-$

$CH_2=CH-CH(CH_3)-CH_3 + H^+ \longrightarrow CH_3-CH^+-CH(CH_3)-CH_3$

But this intermediate product has a resonance:

$CH_3-CH^+-CH(CH_3)-CH_3 \longleftrightarrow C^+H_2-CH2-CH(CH_3)-CH_3$

The reaction with I-

$CH_3-CH^+-CH(CH_3)-CH_3 + I^- \longrightarrow CH_3-CH(I)-CH(CH_3)-CH_3$

$C^+H_2-CH2-CH(CH_3)-CH_3 + I^- \longrightarrow I-CH_2-CH_2-CH(CH_3)-CH_3$

8 0

3 years ago

Which power source uses the earth’s internal heat?

Nataly_w [17]

Answer:

Its geothermal energy.

Explanation:

hope this helps

5 0

3 years ago

G what is the difference between the sidechains of leucine and isoleucine? select one:

statuscvo [17]

c. Isoleucine has a carbon “branched” closer to the alpha carbon than does leucine.

The structure of leucine is CH3CH(CH3)CH2CH(NH2)COOH.

The structure of isoleucine is CH3CH2CH(CH3)CH(NH2)COOH.

In leucine, the CH3 group is two carbons away from the α carbon; in isoleucine, the CH3 group is on the carbon next to the α carbon.

Thus, isoleucine has the closer branched carbon.

“One is charged, the other is not” is incorrect. Both compounds are uncharged.

“One has more H-bond acceptors than the other” is incorrect. Each acid has two H-bond acceptors — the N in the amino and the O in the carbonyl group.

“They have different numbers of carbon atoms” is incorrect. They each contain six carbon atoms.

4 0

3 years ago

Anh measured the temperature of a pond near his house. Before he left for school, the water in the pond was 18 degrees celsius.

Hitman42 [59]

As the temperature increases, B) the molecules started moving faster.

Explanation:

The temperature of a substance is a measure of the average kinetic energy of the particles in a substance. In particular, it can be found that the temperature is directly proportional to the average kinetic energy of the particles:

$T\propto KE$

The kinetic energy of a particle is given by

$KE=\frac{1}{2}mv^2$

where

m is the mass of the particle

v is its speed

This means that the higher the temperature of a substance, the greater the speed of the particles in the substance.

Therefore, if we apply this concept to this problem, we infer that as the temperature of the water in the pond gets higher, the speed of the molecules inside the water increases, which means that the molecules are moving faster.

Therefore, the correct answer is

B) the molecules started moving faster.

Learn more about temperature:

brainly.com/question/1603430

brainly.com/question/4370740

#LearnwithBrainly

3 0

3 years ago