Answer:
yes they are
Explanation:
if you are heating up glass i believe not, unless you want to break the glass. Making glass go from high to low or low to high tempuatures quickly will cause it to break. How ever metal will be stronger as long as you dont bend it.
The total number of atoms remains unchanged, <em>always.</em> But the chemical properties change :)
please rate brainliest! thanks!
B. Infrared light I'm pretty sure correct me if I am wrong hope this helped
A. ?
b. they have lots of pressure
c. the altitude and pressure
why is everyone saying "Will upvote?"
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.