Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
2.7 × 10⁻⁴ bar
Explanation:
Let's consider the following reaction at equilibrium.
SbCl₅(g) ⇄ SbCl₃(g) + Cl₂(g)
The pressure equilibrium constant (Kp) is 3.5 × 10⁻⁴. We can use these data and the partial pressures at equilibrium of SbCl₅ and SbCl₃, to find the partial pressure at equilibrium of Cl₂.
Kp = pSbCl₃ × pCl₂ / pSbCl₅
pCl₂ = Kp × pSbCl₅ / pSbCl₃
pCl₂ = 3.5 × 10⁻⁴ × 0.17 / 0.22
pCl₂ = 2.7 × 10⁻⁴ bar
The one with higher temperature is the one with NaOH as heatis given off during the neutralization reaction that occurs.
<h3>
What is volume?</h3>
Volume can be defined as the amount of space a substance or an objects occupies usually in a closed container.
Volume is measures in litres.
When water is added to dilute acid like HCl, they become more dilute.
When NaOH is added to HCl, a neutralization reaction occurs.
The student will determine the contents of the flasks by adding 10 ml of hcl to each flask. If the NaOH reacts with the Hcl, there will be an increase in temperature.
The increase in temperature is due to the heat of neutralization of the reaction between NaOH and HCl.
Learn more about volume at: brainly.com/question/1972490
#SPJ1
"One atom of Oxygen" would an ion of Ca2+<span>MOST LIKELY ionically bond with in a 1:1 ratio
Hope this helps!</span>
Answer: The hydrogen ion concentration in molarity is 0.013
Explanation:
pH or pOH is the measure of acidity or alkalinity of a solution.
pOH is calculated by taking negative logarithm of hydroxide ion concentration and pH is calculated by taking negative logarithm of hydrogen ion concentration
Putting in the values:
![pOH=-\log[7.609\times 10^{-13}]](https://tex.z-dn.net/?f=pOH%3D-%5Clog%5B7.609%5Ctimes%2010%5E%7B-13%7D%5D)
Now , 
![pH=-\log [H^+]](https://tex.z-dn.net/?f=pH%3D-%5Clog%20%5BH%5E%2B%5D)
![[H^+]=0.013M](https://tex.z-dn.net/?f=%5BH%5E%2B%5D%3D0.013M)
The hydrogen ion concentration in molarity is 0.013
