An Ionic bond is the result of transfer of electrons between atoms
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer: option D. the ability of a base to react with a soluble metal salt.
Justification:
NaOH is a strong base, which means that in water it will dissociate according to this reaction:
- NaOH(aq) → Na⁺ (aq) + OH⁻ (aq)
On the other hand, CuSO₄ is a soluble ionic salt which in water will dissociate into its ions according to this other reaction:
Hence, in solution, the sodium ion (Na⁺) will react with the metal salt in a double replacement reaction, where the highly reactive sodium ion (Na⁺) will substitute the Cu²⁺ in the CuSO₄ to form the sodium sulfate salt, Na₂SO₄ (water soluble), and the copper(II) hydroxide, Cu(OH)₂ (insoluble).
That is what the given reaction represents:
CuSO₄ (aq) + 2NaOH(aq) → Cu(OH)₂(s) + Na₂SO₄(aq)
↑ ↑ ↑ ↑
soluble metal salt strong base insoluble base solube salt
If you are comparing 2 metals, the metal with a higher <u>Number of free ions</u> will react with EDTA first
<h3>What is EDTA ?</h3>
EDTA is a type of chemical which binds certain metal ions such as calcium and magnesium. some of the functions of EDTA includes:
- Preventing blood clotting of blood samples
- prevention of the formation of Biofilm by bacterias
The EDTA will readily react with metals which have a hiogher number of free ions that it can bind with.
Hence we can conclude that If you are comparing 2 metals, the metal with a higher <u>Number of free ions</u> will react with EDTA first.
Learn more about EDTA : brainly.com/question/10818175
Answer:
B. calcium has electrons in more energy levels than magnesium
Explanation:
atoms are made of three types of subatomic particles - electrons, protons and neutrons.
Neutrons and protons reside in the nucleus of the atom and electrons reside in energy shells
electronic configuration for both Ca and Mg are as follows
Mg - 2,8,2
Ca - 2,8,8,2
outermost energy shell of Mg with electrons is the third energy level
whereas outermost energy shell of Ca with electrons is the fourth energy shell
therefore Ca has a larger atomic radius than Mg as it has one more energy shell than Mg in which electrons reside