Speed is the rate at which something goes, and velocity is the average acceleration, which means a car can go slow for a bit, and fast for a bit, and have a velocity of medium. Also, speed is much easier to measure.
Answer:
3,1,4,2
Explanation: the time is the longest for the liquid that has the biggest viscosity
The negative ion in aqueous sodium hydroxide, NaOH(aq) is hydroxide ion, OH-.
<h3>What is a neutralization reaction?</h3>
A neutralization reaction is a reaction between an acid and a base to form salt and water only.
The reaction between vinegar and NaOH is a neutralization reaction which produces a salt and water only.
NaOH is composed of a positive sodium ion, Na+ and a negative hydroxide ion, OH-
Therefore, the negative ion in the NaOH(aq) used in this titration is hydroxide ion, OH-.
Learn more about hydroxide ion at: brainly.com/question/3078877
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.