Answer is: 39,083kJ.
m(coal) = 2,00g.
m(water) = 500g.
ΔT = 43,7°C - 25°C = 18,7°C, <span>difference at temperatures.</span>
c(water) = 4,18 J/g·°C, <span>specific heat of water
</span>Q = m(water)·ΔT·c(water), heat of reaction.
Q = 500g·18,7°C·4,18J/g·°C.
Q = 39083J = 39,083kJ.
Salt solution such as sodium chloride (NaCl) conducts an electric current because it has ions in it that have the freedom to move about in solution. ... On the other hand, sugar solution does not conduct an electric current because sugar (C12H22O11) dissolves in water to produce sugar molecules
Answer:
The answer to the question is
The pressure of carbon dioxide after equilibrium is reached the second time is 0.27 atm rounded to 2 significant digits
Explanation:
To solve the question, we note that the mole ratio of the constituent is proportional to their partial pressure
At the first trial the mixture contains
3.6 atm CO
1.2 atm H₂O (g)
Total pressure = 3.6+1.2= 4.8 atm
which gives
3.36 atm CO
0.96 atm H₂O (g)
0.24 atm H₂ (g)
That is
CO+H₂O→CO(g)+H₂ (g)
therefore the mixture contained
0.24 atm CO₂ and the total pressure =
3.36+0.96+0.24+0.24 = 4.8 atm
when an extra 1.8 atm of CO is added we get Increase in the mole fraction of CO we have one mole of CO produces one mole of H₂
At equilibrium we have 0.24*0.24/(3.36*0.96) = 0.017857
adding 1.8 atm CO gives 4.46 atm hence we have
(0.24+x)(0.24+x)/(4.46-x)(0.96-x) = 0.017857
which gives x = 0.031 atm or x = -0.6183 atm
Dealing with only the positive values we have the pressure of carbon dioxide = 0.24+0.03 = 0.27 atm
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Nuclear energy is called the energy obtained by the transformation of atomic nuclei, so small and heavy clusters of particles inside the atom. Nuclear energy can be produced in two ways, by cleavage or synthesis of nuclei. Heavy nuclei of radioactive elements such as uranium or plutonium, can be split into two nuclei. By splitting are released from the nucleus of neutrons that collide with other nuclei causing them to split and subsequent emission of neutrons. This is called a chain reaction. The condition calls self-sustaining nuclear reaction is slowing down neutrons. For this purpose, a special substance, called moderator. The neutrons collide with the molecules of the moderator precipitate heating speed while the moderator. The resulting heat heats the water so that a couple who drives a turbine generating electricity. Another way of producing nuclear energy is nuclear fusion, in which nuclei combine to light elements. So far, fusion, however, failed to carry out so that it can be applied to the economy as a source of energy.
