Answer:
chlorine is therefore an anion
Answer: The answer is 2.3 x 10 4's.
We can skip option B and D because NaCl is salt and H₂SO₄ is a strong acid.
Neutralization reactions are those reactions in which acid and base react to form salt and water.
As water being amphoteric in nature can react with HCl as follow,
HCl + H₂O ⇆ H₃O⁺ + OH⁻
In this case no salt is formed, so we can skip this option.
Ammonia being a weak base can abstract proton from HCl as follow,
HCl + NH₃ → NH₄Cl
Ammonium Chloride is a salt. So, among all four options, Option-C is the correct answer.
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3