19685 because 1 km in inches is 39370 approximately so you just have to cut it in half
Plutons are large chambers of magma under grown
pegmatites generally form in pluton so it cools slow enough to make the crystals big enough to be classified as pegmatite and not just granite
Answer:
Reforestation can be used to undo and rectify the effects of deforestation and improve the quality of human life by absorbing pollution and dust from the air, rebuilding natural habitats and ecosystems,reducing global warming via biosequestration of atmospheric carbon dioxide, and harvesting for resources, particularly.
Explanation:
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Rubidium is a alkali metal.
