Answer: 
atoms of hydrogen are there in
35.0 grams of hydrogen gas.
Explanation:
According to avogadro's law, 1 mole of every substance occupies 22.4 L at STP and contains avogadro's number 
of particles.
To calculate the moles, we use the equation:
1 mole of hydrogen 
= 
atoms
17.5 mole of hydrogen = 
atoms
There are atoms of hydrogen are there in
35.0 grams of hydrogen gas.
diatomic hydrogen is written as H2 (2.02 grams H2) <------- if each hydrogen atom is 1.01 grams, then two hydrogen atoms are 2.02 grams 2.0 moles H2 X 2.02 grams H2 ------------- (divide to cancel moles) = 4.04 grams/mole H2 ÷ one mole = 4.04 grams H2
Answer:
D atom
Explanation:
The smallest particle of a substance that retains the chemical and physical properties of the substance and is composed of two or more atoms
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
Omg i lost everything ugh
To do it again
1. 12g+2(16g)= 44g/mol
25.01/ 44g/mol= .... mol
2. 14g+3(1g)= 17g/mol
34.05g/ 17g/mol=.... mol
3. 23g+1g+ 12g+ 3(16g)= 84g/mol
17.31g/ 84g/mol=.... mol
4. 6(12g)+12(1g)+6(16g)= 180g/mol
123.44g/ 180g/mol=.... mol
5. 23g+16g+1g= 40g/mol
2.2mol x 40g/mol= .... g
6. 2(35g)= 71g/mol
4.5mol x 71g/mol= .... g
7. 137g+ 2(14g)+ 6(16g)= 261g/mol
0.002mol x 261g/mol= ....g
8. 2(56g)+ 3(32g)+ 12(16g)= 400g/mol
5.4mol x 400g/mol=.... g
I cant believe i had to do this all over
