Should be 18, well i guess I have to have 20 characters so good luck
If your body temperature falls to 95°F (35°C) or lower, you have “hypothermia.” This condition can potentially lead to cardiac arrest, brain damage, or even death. If your body temperature rises as high as 107.6°F (42 °C), you can suffer brain damage or even death.
<span>The Ionization energy decreases because the full s orbital shields the electron entering the p orbital. This is known as "shielding", When each new electron experiences attraction from the nucleus and repulsion forces from the S orbitals, the net force on outer shell electrons is significantly smaller. Therefore, ionization energy decreases during these groups.</span>
Answer:
True.
Explanation:
The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.