Answer:
Fe(s) → Fe²⁺(aq) + 2e⁻ OXIDATION
Mg²⁺(aq) + 2e⁻ → Mg(s) REDUCTION
Explanation:
The redox reaction is: MgCl₂(aq) + Fe(s) → FeCl₂(aq) + Mg(s)
We need to know that elements in ground state have 0 as the oxidation state.
Iron in the reactants, and Mg in the products
In the magnessium chloride, the Mg acts with+2, so the oxidation state has decreased → REDUCTION
In the iron(II) chloride, the Fe acts with +2, so the oxidation statehas increased → OXIDATION
The half reactions are:
Fe(s) → Fe²⁺(aq) + 2e⁻ OXIDATION
Mg²⁺(aq) + 2e⁻ → Mg(s) REDUCTION
2 boxes of A
Because C = A + B
2 of A = 20 grams
at the other hand we have 2 of B = 10
So 20 + 10 = 30 grams
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
B don’t know what light has to do with a ball bouncing
