Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
22.7 liters
The molar volume of an ideal gas depends on the temperature and pressure. One mole of any ideal gas occupies 22.7 liters at 0 0C and 1 bar (STP).
Hope this helped
Answer:
Letters
Explanation:
For example, today we use the periodic table which is full of elements named with 1 or 2 letters. Like how Helium is He and Sodium is Na. Hope this helps!!!
Today scientist don't believe there's life in this solar system but there is proof of living things that once used to live on mars. there might be life in our universe and other galaxies.
Explanation:
