Answer:
4–ethyl–2,3–dimethylheptane
Explanation:
To name the compound given above, do the following:
1. Locate the longest continuous carbon chain. This gives the parent name of the compound. In this case, the longest continuous carbon chain is 7. Thus the parent name is Heptane.
2. Identify the substituent group attached to the compound. In this case, the substituent group attached are:
a. Methyl (–CH₃). There are two methyl group attached.
b. Ethyl (–CH₂CH₃)
3. Locate the position of the substituent group attached to the compound by naming alphabetically.
a. The two Methyl (–CH₃) groups are located at carbon 2 and 3
b. The Ethyl (–CH₂CH₃) is located at carbon 4.
NOTE: The position of the Ethyl (–CH₂CH₃) group is the same from both side so we consider the lowest count for the methyl group.
4. Combine the above to obtain the name of the compound.
The name of the compound is:
4–ethyl–2,3–dimethylheptane
Answer:
C. AlCl3 is a covalent compound.
Explanation:
It is formed by mutual sharing of electrons between two atoms each contributing equal number of electrons to the electron pair.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
1) The main disadvantage of bio plastics is that when they break down , carbondioxide is released and results into global warming.
2) They are designed to be composted , not recycled.
3) fewer proper composting availability.
4) plants grown for bioplastics have negative impacts of their own.
