Answer:
Qualitative Analysis is the determination of non-numerical information about a chemical species, a reaction, etc. Examples would be observing that a reaction is creating gas that is bubbling out of solution or observing that a reaction results in a color change.
Explanation:
Natural transmutation is the spontaneous disintegration of a heavy nuclide into lighter ones or fusion of lighter nuclides into heavier ones. These processes occurs naturally without anything inducing them. Nuclear fission of light elements in the core of stars is an example of natural transmutation.
- Typically, all nuclei with atomic number greater than 83 are naturally radioactive.
²³⁸₉₂U → ²³⁴₉₂Th + ⁴₂He
In artificial transmutation, nuclear reactions are initiated through the collision of a nuclide with a high speed particle. Here, unstable nuclei are produced artificially in nuclear reactions. Such unstable nuclei also produce radiations.
¹₀n + ²³₁₁Na → ²⁴₁₁Na + γ
Learn more:
Transmutation brainly.com/question/3433940
#learnwithBrainly
Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
<span>The filament of the light bulb will get very hot. This will encourage a chemical reaction with most gases that are surrounding that filament - and the result is that the filament burns out. If the filament is in air, it combines with the carbon of carbon dioxide in the air, and the filament disintegrates. But argon is an inert gas - almost nothing reacts with it. So the filament takes a very long time (theoretically infinity) to burn out. But the bulb cannot contain 100% argon: 99.9% is typical; the remaining 0.1% being air. The bulb manufacturers can control the 'life' of a bulb, based on that principle: they do not want their bulbs to last forever!</span>
