Answer:
Explanation: Mendeleev arranged the elements on the basis of their atomic mass. Melting and boiling point were used as the physical characteristics in deciding the position of elements. He arranged the elements and wrote the formula of their oxides and hydrides which seemed to possess same chemical formula.
Explanation:
Answer:
14 mol e⁻
Explanation:
Step 1: Write the balanced half-reaction for the reduction of permanganate to manganese
8 H⁺(aq) + 7 e⁻ + MnO₄⁻(aq) ⇒ Mn(s) + 4 H₂O(l)
Step 2: Calculate the moles corresponding to 110 g of manganese
The molar mass of Mn is 55 g/mol.
110 g × 1 mol/55 g = 2 mol
Step 3: Calculate the number of moles of electrons needed to produce 2 moles of Mn
According to the half-reaction, 7 moles of electrons are required to produce 1 mole of Mn.
2 mol Mn × 7 mol e⁻/1 mol Mn = 14 mol e⁻
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
The metric system goes by powers of ten, so it's very easy to measure. That would be the main advantage, measurements of ten. We can also say it's the most used measurement around the world, so all scientists have little to no conversion, but the main answer is probably the first one :)
Answer:
Hi, There! the Correct Answer is below!
C.)interactions between humans and living and non-living things in the environment
Explanation:
Environmental scientists study subjects like the understanding of earth processes, evaluating alternative energy systems, pollution control and mitigation, natural resource management, and the effects of global climate change. ... Environmental scientists bring a systems approach to the analysis of environmental problems.
____________________________________________________________
Have a wonderful Day :)
~Darkspirit~
