All categories

3 years ago

Balance the equation KCIO3–> O2+ KCI

Chemistry

2 answers:

Rus_ich [418]3 years ago

7 0

Explanation:

2KCLO3=3O2+2KC

hope this helps

harina [27]3 years ago

3 0

Answer: 2KCIO3–> 3O2+ 2KCI

Explanation:

You might be interested in

What is the vitamin in an apple?

bulgar [2K]

Answer:

98 IU

Vitamin A

Explanation:

3 0

3 years ago

Read 2 more answers

What is the molar mass of KCI

9966 [12]

Answer:

178.01347 ± 0.00093 g/mol

Explanation:

7 0

3 years ago

2. ATO kg bouting ball would require what force to accelerate down an alleyway at a rate of ons?

Mars2501 [29]

Answer:

2. 30N

3. 5,000N

4. 15 kg

5. 2,800 kg

Explanation:

2. A 10 kg bowling ball would require what force to accelerate down an alleyway at a rate of 3m/s² ?

Notice that I completed the question with the garbled and missing values:

Data:

F = ?

m = 10 kg

a = 3m/s²

Physical principles:

Newton's second law: $F=m\times a$

Solution:

Substitute and compute

$F=10kg\times 3m/s^2=30N$

3. Salty has a car that accelerates at 5 m/s². If the car has a mass of 1000 kg, how much force does the car produce?

Notice that I arranged the typos.

Data:

F = ?

m = ?

a = ?

Physical principles:

Newton's second law: $F=m\times a$

Solution:

Substitute and compute

$F=1,000kg\times5m/s^2=5,000N$

4. What is the mass of a falling rock if it produces a force of 147 N?

Data:

F = 147N

m = ?

a = falling rock

Physical principles:

neglecting air resistance ⇒ a = g: gravitational acceleration: 9.8m/s²

Newton's second law: $F=m\times a$

Solution:

Clear m from Newton's second law

$m=\dfrac{F}{a}$

Substitute with F = 147 N and a = g = 9.8m/s², and compute

$m=\dfrac{147N}{9.8m/s^2}=15Kg$

5. What is the mass of a truck if it produces a force of 14,000 N while accelerating at a rate of 5 m/s²?

Data:

F= 14,000N

m = ?

a = 5m/s²

Physical principles:

Second Newton's law: $F=m\times a$

Solution:

Clear m from Newton's second law

$m=\dfrac{F}{a}$

Substitute with F = 14,000 N and a = 5m/s², and compute

$m=\dfrac{14,000N}{5m/s^2}=2,800kg$

6 0

3 years ago

Linolenic acid has cis double bonds with the formula ch3ch2ch=chch2ch=chch2ch=ch(ch2)7cooh. write out the abbreviated systematic

valentinak56 [21]

Abbreviated systematic numbering for Linolenic Acid is,

18:3, n-3
Explanation:
In above abbreviation 18 specifies number of carbon atoms in Linolenic Acid, 3 specifies the number of double bonds and n-3 specifies the position of first double bond from methyl end. The structure of Linolenic Acid is as follow,

3 0

4 years ago

Calculate the pOH of a solution that contains 3.9 x 10-5 M H3O+ at 25°C.

exis [7]

Answer:

Option b. 9.59

Explanation:

First, let us calculate the pH. This is illustrated below:

[H3O+] = 3.9 x 10-5 M

pH = —Log [H3O+]

pH = —Log [3.9 x 10-5]

pH = 4.41

Recall: pH + pOH = 14

4.41 + pOH = 14

Collect like terms

pOH = 14 — 4.41

pOH = 9.59

6 0

4 years ago