Answer:
i going to be aniston i would say take a gess
Answer:
Polymerization.
Explanation:
Polymerization can be defined as a type of chemical reaction in which molecules that are relatively small in size chemically combine to form a huge chain of molecules.
Simply stated, polymerization refers to a chemical reaction where two or more smaller molecules react to produce larger molecules of the same network or repetitive structural units.
In polymerization, the relatively small molecules are generally referred to as monomers while the larger molecules they produce are known as polymers.
Polymerization is given by the chemical formula;
nA -----> A(n).
In this scenario, Luis uses a stencil to repeat the same design on each wall to form one long grapevine with a bunch of grapes every foot along its length.
Hence, the type of chemical reaction this best model is polymerization because it involved repeating the same design (monomers) to form a long grapevine with a bunch of grapes (polymers).
Answer:
Option C :
a chemical formula that shows the relative number of each type of atom in a molecule, using the smallest possible ratio
Explanation:
Empirical Formula:
Empirical formula is the simplest ration of atoms in the molecule but not all numbers of atoms in a compound.
So,
Tha ration of the molecular formula should be divided by whole number to get the simplest ratio of molecule
For Example
C₂H₆O₂ Consist of Carbon (C), Hydrogen (H), and Oxygen (O)
Now
Look at the ratio of these three atoms in the compound
C : H : O
2 : 6 : 2
Divide the ratio by two to get simplest ratio
C : H : O
2/2 : 6/2 : 2/2
1 : 3 : 1
So for the empirical formula the simplest ratio of carbon to hydrogen to oxygen is 1:3:1
So the empirical formula will be
Empirical formula of C₂H₆O₂ = CH₃O
So, Option C is correct :
a chemical formula that shows the relative number of each type of atom in a molecule, using the smallest possible ratio
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane