They are kind of opposite processes. Chemical synthesis is execution of chemical reactions to make products. Like you take two substances, you put them together, they react and you have new a substance. For example.
here Sodium and Chlorine react to make a new substance which is Sodium Chloride.
Chemical decomposition is process of seperating a substance to different substances. There is a substance by a reaction this substance becomes two substances, Like : XY -> X+Y For example :
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
<span>(a) what is the average volume (in cubic meters) required for each iron atom
For this case, the density of Iron would be </span>7.87g/cm³
<span>
V = 9.27 x 10^-26 kg / </span>7.87g/cm<span>³ ( 1 kg / 1000 g)
</span>V = 1.18 x 10-23 cm³<span>
(b) what is the distance (in meters) between the centers of adjacent atoms?
We assume the atoms as cube, so we use the volume of the cube to calculate the distance of the atoms.
V = </span>1.18 x 10-23 cm<span>³ = s</span>³
s = 2.28 x 10^-8 cm
The remaining moles of C is 5.01 moles while the remaining moles of F₂ is 0.
<h3>
Reaction between Carbon and Fluorine </h3>
The reaction between carbon and Fluorine is given as;
C + 2F₂ -------> CF₄
1 : 2 1
from the reaction above,
2 moles of F₂ requires 1 mole of C
7.88 mole of F₂ will require: 7.88/2 = 3.94 moles of C and 3.94 moles of CF₄.
The remaining moles of C = 8.95 - 3.94 = 5.01 moles while the remaining moles of F₂ is 0.
Learn more about moles here: brainly.com/question/15356425
#SPJ1
