The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
If there reacted 1.5 moles of O2, there will be produced 1.0 mol of Fe2O3
Explanation:
Step 1: Data given
Number of moles oxygen reacted = 1.5 moles
Step 2: The balanced equation
4Fe + 3O2 → 2Fe2O3
Step 3: Calculate moles of Fe2O3
For 4 moles Fe consumed, we need 3 moles of O2 to produce 2 moles of Fe2O3
For 1.5 moles O2 consumed, we'll have 2/3 * 1.5 = 1.0 mol of Fe2O3
If there reacted 1.5 moles of O2, there will be produced 1.0 mol of Fe2O3
For example...
You have solution with [H+] = 0,01M
>>>> pH = -log[H+] = -log0,01 = 2
And you increase the [H+] by 10x ---> 0,01×10 = 0,1M
>>>> pH = -log0,1 = 1
○ pH decrease by 2x
○ pH is more acidic
Answer:
C) LiOH + HCl → LiCl + H₂O
General Formulas and Concepts:
<u>Chemistry - Reactions</u>
- Synthesis Reactions: A + B → AB
- Decomposition Reactions: AB → A + B
- Single-Replacement Reactions: A + BC → AB + C
- Double-Replacement Reactions: AB + CD → AD + BC
Explanation:
<u>Step 1: Define</u>
RxN A: 2Na + 2H₂O → 2NaOH + H₂
RxN B: CaCO₃ → CaO + CO₂
RxN C: LiOH + HCl → LiCl + H₂O
RxN D: CH₄ + 2O₂ → CO₂ + 2H₂O
<u>Step 2: Identify</u>
RxN A: Single Replacement Reaction
RxN B: Decomposition Reaction
RxN C: Double Replacement Reaction
RxN D: Combustion Reaction
