The answer is B) Miami, Florida.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Raise the boiling temperature
Answer:
0.64 g O₂
Explanation:
I am assuming you meant 0.02 moles of O₂. In that case, convert moles to mass via stoichiometry:
0.02 mol O₂ x 32 g O₂/1 mol O₂ = 0.64 g O₂