Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
I got a 4 out of 1. not 100 percent sure if this is the right answer but i put 1,2,1,2
Sound energy is produced by vibrating objects.
Example: when you speak you vibrate the air molecules in the air. If you where to speak in space no “sound” would be produced since there is nothing for the vibration of your voice to travel through.
