Air masses form fronts when B, they collide with each other
Answer:
8.32 s⁻¹
Explanation:
Given that:
The concentration of myosin = 25 pmol/L
R_max = 208 pmol/L/s
The objective is to determine the turnover number of the enzyme molecule myosin, which has a single active site.
In a single active site of enzyme is known to be a region where there is binding of between substrate molecules, thereafter undergoing chemical reaction.
The turnover number of the enzyme is said to be the number of these substrate molecule which binds together are being converted into products.
The turnover number of the enzyme molecule of myosin can be calculated by the expression: 
⇒ 
= 8.32 s⁻¹
A semiconductor conducts electricity at high temperatures, but not at low temperatures. At high temperatures, metalloids act like metals and conduct electricity.
Explanation:
start using quizlet. it has every anwser
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane