Answer:
The energy change in a chemical reaction is due to the difference in the amounts of stored chemical energy between the products and the reactants. This stored chemical energy, or heat content, of the system is known as its enthalpy.
Explanation:
if u want to u can give me the crown btw have a good day
Answer:
5 seconds
Explanation:
Speed x Time. So t=ds. t=51=5.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
Speeding up: graph 6
Slowing down: graph 1
Fast Constant Speed, forward: graph 2
Slow constant speed, forward: graph 5
Fast constant speed, Backward: graph 4
Slow constant speed, Backward: graph 7
Sitting still: graph 3
(Im not 100% but this makes the most sense i think)
Full electron configuration of barium: 1s2 2s2 2p6 3s2 3p6 3d10 4s2 4p6 4d10 5s2 5p6 6s2