All categories

1 year ago

There are ________ mol of bromide ions in 0.700 L of a 0.400 M solution of AlBr

Chemistry

1 answer:

denis23 [38]1 year ago

5 0

Answer:

The number of moles of AlBr3 = Molarity × Volume

= 0.400 × 0.700

= 0.28 moles

1 mole of AlBr3 gives 3 moles of Br- ions

That is

AlBr3 = Al3+ + 3Br-

Therefore, 0.045 moles of AlBr3 will yield 3 × 0.28 = 0.84 moles

Thus; they are 0.84 moles of bromide ions

You might be interested in

Can somebody explain step by step how to solve decomposition reactions?

SVEN [57.7K]

A decomposition reaction occurs when one reactant breaks down into two or more products. It can be represented by the general equation:

AB → A + B
In this equation, AB represents the reactant that begins the reaction, and A and B represent the products of the reaction. The arrow shows the direction in which the reaction occurs.

7 0

2 years ago

The chemical reaction 2Cu + O2 → 2CuO + 315 kJ is an _____ reaction. Endothermic, combustion Exothermic, combustion Endothermic,

makvit [3.9K]

the awnser is exothermic (combustion)

4 0

3 years ago

Read 2 more answers

Can you explain so I can understand

Art [367]

It would be insulator because an insulator kills electricity, it can't travel through it.

4 0

2 years ago

Read 2 more answers

When is di- used in the name of a hydrocarbon?

harkovskaia [24]

Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane

6 0

2 years ago

Calculate the pKa of lactic acid (CH3CH(OH)COOH) given the following information. 3.005 grams of potassium lactate are added to

snow_lady [41]

Answer:

$\displaystyle \text{p} K_a \approx 3.856$

Explanation:

Because 3.005 grams of potassium lactate is added to 100. mL of solution, its concentration is:

$\displaystyle \begin{aligned} \left[ \text{KC$_3$H_$_5$O$_3$}\right] & = \frac{3.005\text{ g KC$_3$H_$_5$O$_3$}}{100.\text{ mL}} \cdot \frac{1\text{ mol KC$_3$H_$_5$O$_3$}}{128.17 \text{ g KC$_3$H_$_5$O$_3$}} \cdot \frac{1000\text{ mL}}{1\text{ L}} \\ \\ &= 0.234\text{ M}\end{aligned}$

By solubility rules, potassium is completely soluble, so the compound will dissociate completely into potassium and lactate ions. Therefore, [KC₃H₅O₃] = [C₃H₅O₃⁺]. Note that lactate is the conjugate base of lactic acid.

Recall the Henderson-Hasselbalch equation:

$\displaystyle \begin{aligned}\text{pH} = \text{p}K_a + \log \frac{\left[\text{Base}\right]}{\left[\text{Acid}\right]} \end{aligned}$

[Base] = 0.234 M and [Acid] = 0.500 M. We are given that the resulting pH is 3.526. Substitute and solve for p<em>Kₐ</em>:

$\displaystyle \begin{aligned} (3.526) & = \text{p}K_a + \log \frac{(0.234)}{(0.500)} \\ \\ 3.526 & = \text{p}K_a + (-0.330) \\ \\ \text{p}K_a & = 3.856\end{aligned}$

In conclusion, the p<em>Kₐ </em>value of lactic acid is about 3.856.

5 0

1 year ago