First you need to balance the equation. Ba(OH)2+2HNO3=Ba(NO3)2+H2O. Then you can get the ratio of mole number of the reactants. The ratio is Ba(OH)2:HNO3=1:2. So the molarity of Ba(OH)2 is 38.5*0.85/2/20=0.82 molar.
Gravity depends on distance and the moon is closer to earth
Answer:
ʟᴇᴛᴛᴇʀ: ᴄ.
Explanation:
ɪʙᴀ ᴀɴɢ ᴇxᴘʟᴀɴᴀᴛɪᴏɴ sᴀ ʟᴀʜᴀᴛ ɴɢ ᴀɴsᴡᴇʀ
Among the choices, bromine exists as liquid under standard temperature and pressure conditions. Unlike other diatomic molecules which exist as gases, due to its heavy molecular weight, it exists as solid. Francium and cesium are solids while iodine is gas.Answer is 1.