Answer:
4552 mL
Explanation:
From the question given above, the following data were obtained:
Volume of stock solution (V₁) = 55 mL
Molarity of stock solution (M₁) = 12 M
Molarity of diluted solution (M₂) = 0.145 M
Volume of diluted solution (V₂) =?
The volume of the diluted solution can be obtained by using the dilution formula as illustrated below:
M₁V₁ = M₂V₂
12 × 55 = 0.145 × V₂
660 = 0.145 × V₂
Divide both side by 0.145
V₂ = 660 / 0.145
V₂ ≈ 4552 mL
Thus, the volume of the diluted solution is 4552 mL
<span>b. an atom’s outer energy level doesn't have the maximum number of electrons.</span>
A carbon which is attached to four different atoms or group of atoms with different environment is called as
Chiral Carbon or
Asymmetric Carbon.
Non-<span>
superimposable:
</span> The mirror image (molecule) of chiral carbon cotaining compounds are Non.Superimposable on each other. They are called enantiomers of each other.
Polarized Light and Chiral Carbon: When a polarized light is allowed to fall on either enantiomer of chiral compound, it is rotated other clockwise or anti-clockwise.
Examples: Below are three axamples of compounds containing chiral carbon.
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>