The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
A. releases a large amount of heat
Explanation:
A reaction is said to be spontaneous if it can proceed on its own without the addition of external energy. A spontaneous reaction is not determined by the length of time, because some spontaneous reactions are completed after a long period of time. They are exothermic in nature. An example is the conversion of graphite to carbon which takes a long period of time to complete. Spontaneous reactions are known to increase entropy in a system. Entropy is the rate of disorder in a system.
In the combustion of fire, energy is released to the surroundings as there is a decrease in energy. This is an example of a spontaneous reaction because it is an exothermic reaction, which causes an increase in entropy and a decrease in energy.
The steam releases 39.9 kJ when it condenses..
The steam condenses and transfers its energy to the skin.
<em>q = m</em>Δ<em>H</em>_cond = 17.7 g × (-2257 J/1 g) = -39 900 kJ = -39.9 kJ
The negative sign shows that the steam is releasing energy
They have the same number of electrons in their outer shells. Elements in the same group often share similar chemical properties because the outer electrons generally determine a lot of their properties
compound name compound formula elements present
water H2O hydrogen (H) and oxygen (O)
ammonia NH3 nitrogen (N) and hydrogen (H)
carbon monoxide CO carbon (C) and oxygen (O)
carbon dioxide CO2 carbon (C) and oxygen (O)
