Water is made up of atoms bonded to form molecules, the chemical formula for water is H20, and 1 side has a positive charge, while the other has a negative one.
<h3>What is water?</h3>
Water is a fundamental molecule for life on the Earth due to its physico-chemical properties.
The water formula is H2O, which means that this molecule is composed of two atoms of Hydrogen and one atom of Oxygen.
In conclusion, Water is made up of atoms bonded to form molecules, the chemical formula for water is H20, and 1 side has a positive charge, while the other has a negative one.
Learn more on water properties here:
brainly.com/question/18681949
#SPJ1
Label each statement with its corresponding type of scientific knowledge.
law
theory
fact
hypothesis
The melting point of ice is 0°C: thus is a fact based on repetitive experiments
Repeated observations have consistently
shown that oppositely charged objects
attract each other: this is law
When the elements carbon and nitrogen
are mixed at 1500°C, they will react
with each other.
this is a hypothesis
Atoms are made of protons, neutrons,
and electrons. Although we can’t directly
see these particles, this structure
explains many experimental observations
Theory
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
Answer:
1 mole is equal to 1 moles Arsenic Trichloride, or 181.2806 grams.
Explanation:
The solubility of substance depends upon the temperature. In present case, the solubility of KCl is 84g/100g at <span>50.oC.
This means that, maximum 84g of KCl can be dissolved in 100g of water (at </span>50.oC) to form solution. This solution is referred as saturated solution.
Thus, 84g of <span>KNO3 must be dissolve in 100 grams of water to form a saturated solution at 50 oC.</span>